C21H25NO6S — CID 8857900
(2,5-dimethoxyphenyl)methyl 3-piperidin-1-ylsulfonylbenzoate (PubChem CID 8857900) has the molecular formula C21H25NO6S and a molecular weight of 419.50 g/mol. Its IUPAC name is (2,5-dimethoxyphenyl)methyl 3-piperidin-1-ylsulfonylbenzoate.
| Compound Name | (2,5-dimethoxyphenyl)methyl 3-piperidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 8857900 |
| Molecular Formula | C21H25NO6S |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | (2,5-dimethoxyphenyl)methyl 3-piperidin-1-ylsulfonylbenzoate |
| SMILES | COc1ccc(OC)c(COC(=O)c2cccc(S(=O)(=O)N3CCCCC3)c2)c1 |
| InChI | InChI=1S/C21H25NO6S/c1-26-18-9-10-20(27-2)17(13-18)15-28-21(23)16-7-6-8-19(14-16)29(24,25)22-11-4-3-5-12-22/h6-10,13-14H,3-5,11-12,15H2,1-2H3 |
| InChIKey | VMNPCZFHOVWOOL-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |