C20H39BO5Si2 — CID 88579846
CID 88579846 (PubChem CID 88579846) has the molecular formula C20H39BO5Si2 and a molecular weight of 426.51 g/mol.
| Compound Name | CID 88579846 |
|---|---|
| PubChem CID | 88579846 |
| Molecular Formula | C20H39BO5Si2 |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.24 |
| IUPAC Name | — |
| SMILES | [B]C1OC2CO[Si](C(C)C)(C(C)C)O[Si](C(C)C)(C(C)C)O[C@H]2[C@@]1(O)CC=C |
| InChI | InChI=1S/C20H39BO5Si2/c1-10-11-20(22)18-17(24-19(20)21)12-23-27(13(2)3,14(4)5)26-28(25-18,15(6)7)16(8)9/h10,13-19,22H,1,11-12H2,2-9H3/t17?,18-,19?,20+/m1/s1 |
| InChIKey | QRKVXCWWEZKSBJ-NBDWZHNGSA-N |
| XLogP | 4.14 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|