C26H56O4Si3 — CID 11027689
[(2S,3S,4R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-2-prop-2-enyloxolan-2-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 11027689) has the molecular formula C26H56O4Si3 and a molecular weight of 516.99 g/mol. Its IUPAC name is [(2S,3S,4R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-2-prop-2-enyloxolan-2-yl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [(2S,3S,4R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-2-prop-2-enyloxolan-2-yl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 11027689 |
| Molecular Formula | C26H56O4Si3 |
| Molecular Weight | 516.99 g/mol |
| Exact Mass | 516.35 |
| IUPAC Name | [(2S,3S,4R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-2-prop-2-enyloxolan-2-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | C=CC[C@@]1(CO[Si](C)(C)C(C)(C)C)OC[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H56O4Si3/c1-17-18-26(20-28-31(11,12)23(2,3)4)22(30-33(15,16)25(8,9)10)21(19-27-26)29-32(13,14)24(5,6)7/h17,21-22H,1,18-20H2,2-16H3/t21-,22+,26+/m1/s1 |
| InChIKey | XQBGIHJCRUAWJE-UFPGJGBJSA-N |
| XLogP | 8.13 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.99 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|