C26H56O4Si3 — CID 11677974
[(1R)-1-[(2S,3S,4S,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-ethenyloxolan-2-yl]ethoxy]-tert-butyl-dimethylsilane (PubChem CID 11677974) has the molecular formula C26H56O4Si3 and a molecular weight of 516.99 g/mol. Its IUPAC name is [(1R)-1-[(2S,3S,4S,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-ethenyloxolan-2-yl]ethoxy]-tert-butyl-dimethylsilane.
| Compound Name | [(1R)-1-[(2S,3S,4S,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-ethenyloxolan-2-yl]ethoxy]-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 11677974 |
| Molecular Formula | C26H56O4Si3 |
| Molecular Weight | 516.99 g/mol |
| Exact Mass | 516.35 |
| IUPAC Name | [(1R)-1-[(2S,3S,4S,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-ethenyloxolan-2-yl]ethoxy]-tert-butyl-dimethylsilane |
| SMILES | C=C[C@H]1O[C@@H]([C@@H](C)O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H56O4Si3/c1-18-20-22(29-32(14,15)25(6,7)8)23(30-33(16,17)26(9,10)11)21(27-20)19(2)28-31(12,13)24(3,4)5/h18-23H,1H2,2-17H3/t19-,20-,21+,22+,23+/m1/s1 |
| InChIKey | IXHZJWBBOWCTIM-VROINQGHSA-N |
| XLogP | 8.13 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.99 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|