C20H42O3Si2 — CID 176718331
tert-butyl-[2-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-prop-2-enyloxolan-3-yl]oxy-dimethylsilane (PubChem CID 176718331) has the molecular formula C20H42O3Si2 and a molecular weight of 386.73 g/mol. Its IUPAC name is tert-butyl-[2-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-prop-2-enyloxolan-3-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[2-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-prop-2-enyloxolan-3-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 176718331 |
| Molecular Formula | C20H42O3Si2 |
| Molecular Weight | 386.73 g/mol |
| Exact Mass | 386.27 |
| IUPAC Name | tert-butyl-[2-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-prop-2-enyloxolan-3-yl]oxy-dimethylsilane |
| SMILES | C=CCC1(CO[Si](C)(C)C(C)(C)C)OCCC1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H42O3Si2/c1-12-14-20(16-22-24(8,9)18(2,3)4)17(13-15-21-20)23-25(10,11)19(5,6)7/h12,17H,1,13-16H2,2-11H3 |
| InChIKey | KLIIBTRTIMAWMF-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.73 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|