C17H34O4Si — CID 10782685
(2S,3S,4R)-2-prop-2-enyl-2-[tri(propan-2-yl)silyloxymethyl]oxolane-3,4-diol (PubChem CID 10782685) has the molecular formula C17H34O4Si and a molecular weight of 330.54 g/mol. Its IUPAC name is (2S,3S,4R)-2-prop-2-enyl-2-[tri(propan-2-yl)silyloxymethyl]oxolane-3,4-diol.
| Compound Name | (2S,3S,4R)-2-prop-2-enyl-2-[tri(propan-2-yl)silyloxymethyl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 10782685 |
| Molecular Formula | C17H34O4Si |
| Molecular Weight | 330.54 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | (2S,3S,4R)-2-prop-2-enyl-2-[tri(propan-2-yl)silyloxymethyl]oxolane-3,4-diol |
| SMILES | C=CC[C@@]1(CO[Si](C(C)C)(C(C)C)C(C)C)OC[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C17H34O4Si/c1-8-9-17(16(19)15(18)10-20-17)11-21-22(12(2)3,13(4)5)14(6)7/h8,12-16,18-19H,1,9-11H2,2-7H3/t15-,16+,17+/m1/s1 |
| InChIKey | FBRMOJFAHRAGRM-IKGGRYGDSA-N |
| XLogP | 3.25 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.54 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|