C16H32O — CID 88580600
(Z)-6,9,9-trimethyl-7-propan-2-yldec-4-en-3-ol (PubChem CID 88580600) has the molecular formula C16H32O and a molecular weight of 240.43 g/mol. Its IUPAC name is (Z)-6,9,9-trimethyl-7-propan-2-yldec-4-en-3-ol.
| Compound Name | (Z)-6,9,9-trimethyl-7-propan-2-yldec-4-en-3-ol |
|---|---|
| PubChem CID | 88580600 |
| Molecular Formula | C16H32O |
| Molecular Weight | 240.43 g/mol |
| Exact Mass | 240.25 |
| IUPAC Name | (Z)-6,9,9-trimethyl-7-propan-2-yldec-4-en-3-ol |
| SMILES | CCC(O)/C=C\C(C)C(CC(C)(C)C)C(C)C |
| InChI | InChI=1S/C16H32O/c1-8-14(17)10-9-13(4)15(12(2)3)11-16(5,6)7/h9-10,12-15,17H,8,11H2,1-7H3/b10-9- |
| InChIKey | YHAYFGPEVOVOIL-KTKRTIGZSA-N |
| XLogP | 4.66 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.43 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|