C14H29N — CID 137429083
(Z,4R)-N,2,2,7,8-pentamethylnon-5-en-4-amine (PubChem CID 137429083) has the molecular formula C14H29N and a molecular weight of 211.39 g/mol. Its IUPAC name is (Z,4R)-N,2,2,7,8-pentamethylnon-5-en-4-amine.
| Compound Name | (Z,4R)-N,2,2,7,8-pentamethylnon-5-en-4-amine |
|---|---|
| PubChem CID | 137429083 |
| Molecular Formula | C14H29N |
| Molecular Weight | 211.39 g/mol |
| Exact Mass | 211.23 |
| IUPAC Name | (Z,4R)-N,2,2,7,8-pentamethylnon-5-en-4-amine |
| SMILES | CN[C@@H](/C=C\C(C)C(C)C)CC(C)(C)C |
| InChI | InChI=1S/C14H29N/c1-11(2)12(3)8-9-13(15-7)10-14(4,5)6/h8-9,11-13,15H,10H2,1-7H3/b9-8-/t12?,13-/m0/s1 |
| InChIKey | IURYVXXKSVWLLE-COUHGGSKSA-N |
| XLogP | 3.86 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.39 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|