C21H22O4S — CID 88581314
S-[[(1R,2S,6R,7S)-5-hydroxy-3-oxo-4-(2,4,6-trimethylphenyl)-10-oxatricyclo[5.2.1.02,6]deca-4,8-dien-1-yl]methyl] ethanethioate (PubChem CID 88581314) has the molecular formula C21H22O4S and a molecular weight of 370.47 g/mol. Its IUPAC name is S-[[(1R,2S,6R,7S)-5-hydroxy-3-oxo-4-(2,4,6-trimethylphenyl)-10-oxatricyclo[5.2.1.02,6]deca-4,8-dien-1-yl]methyl] ethanethioate.
| Compound Name | S-[[(1R,2S,6R,7S)-5-hydroxy-3-oxo-4-(2,4,6-trimethylphenyl)-10-oxatricyclo[5.2.1.02,6]deca-4,8-dien-1-yl]methyl] ethanethioate |
|---|---|
| PubChem CID | 88581314 |
| Molecular Formula | C21H22O4S |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | S-[[(1R,2S,6R,7S)-5-hydroxy-3-oxo-4-(2,4,6-trimethylphenyl)-10-oxatricyclo[5.2.1.02,6]deca-4,8-dien-1-yl]methyl] ethanethioate |
| SMILES | CC(=O)SC[C@]12C=C[C@H](O1)[C@@H]1C(O)=C(c3c(C)cc(C)cc3C)C(=O)[C@@H]12 |
| InChI | InChI=1S/C21H22O4S/c1-10-7-11(2)15(12(3)8-10)17-19(23)16-14-5-6-21(25-14,9-26-13(4)22)18(16)20(17)24/h5-8,14,16,18,23H,9H2,1-4H3/t14-,16-,18+,21-/m0/s1 |
| InChIKey | DHNLQAIAJBGFMI-USOFNBIVSA-N |
| XLogP | 3.68 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|