C29H26ClFN8O2 — CID 88582283
(E)-3-[2-[amino-[(Z)-(methylidenehydrazinylidene)methyl]amino]-5-chlorophenyl]-N-[(1S)-1-[5-(4-aminophenyl)-6-oxo-1H-pyridazin-3-yl]-2-(4-fluorophenyl)ethyl]prop-2-enamide (PubChem CID 88582283) has the molecular formula C29H26ClFN8O2 and a molecular weight of 573.03 g/mol. Its IUPAC name is (E)-3-[2-[amino-[(Z)-(methylidenehydrazinylidene)methyl]amino]-5-chlorophenyl]-N-[(1S)-1-[5-(4-aminophenyl)-6-oxo-1H-pyridazin-3-yl]-2-(4-fluorophenyl)ethyl]prop-2-enamide.
| Compound Name | (E)-3-[2-[amino-[(Z)-(methylidenehydrazinylidene)methyl]amino]-5-chlorophenyl]-N-[(1S)-1-[5-(4-aminophenyl)-6-oxo-1H-pyridazin-3-yl]-2-(4-fluorophenyl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 88582283 |
| Molecular Formula | C29H26ClFN8O2 |
| Molecular Weight | 573.03 g/mol |
| Exact Mass | 572.19 |
| IUPAC Name | (E)-3-[2-[amino-[(Z)-(methylidenehydrazinylidene)methyl]amino]-5-chlorophenyl]-N-[(1S)-1-[5-(4-aminophenyl)-6-oxo-1H-pyridazin-3-yl]-2-(4-fluorophenyl)ethyl]prop-2-enamide |
| SMILES | C=N/N=C\N(N)c1ccc(Cl)cc1/C=C/C(=O)N[C@@H](Cc1ccc(F)cc1)c1cc(-c2ccc(N)cc2)c(=O)[nH]n1 |
| InChI | InChI=1S/C29H26ClFN8O2/c1-34-35-17-39(33)27-12-7-21(30)15-20(27)6-13-28(40)36-25(14-18-2-8-22(31)9-3-18)26-16-24(29(41)38-37-26)19-4-10-23(32)11-5-19/h2-13,15-17,25H,1,14,32-33H2,(H,36,40)(H,38,41)/b13-6+,35-17-/t25-/m0/s1 |
| InChIKey | LVJKQUJSEKNJEE-WEOICPSGSA-N |
| XLogP | 4.25 |
| TPSA | 154.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.03 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|