C11H13ClN4 — CID 88909481
N-amino-N-[4-chloro-2-[(E)-prop-1-enyl]phenyl]-N'-(methylideneamino)methanimidamide (PubChem CID 88909481) has the molecular formula C11H13ClN4 and a molecular weight of 236.71 g/mol. Its IUPAC name is N-amino-N-[4-chloro-2-[(E)-prop-1-enyl]phenyl]-N'-(methylideneamino)methanimidamide.
| Compound Name | N-amino-N-[4-chloro-2-[(E)-prop-1-enyl]phenyl]-N'-(methylideneamino)methanimidamide |
|---|---|
| PubChem CID | 88909481 |
| Molecular Formula | C11H13ClN4 |
| Molecular Weight | 236.71 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | N-amino-N-[4-chloro-2-[(E)-prop-1-enyl]phenyl]-N'-(methylideneamino)methanimidamide |
| SMILES | C=N/N=C\N(N)c1ccc(Cl)cc1/C=C/C |
| InChI | InChI=1S/C11H13ClN4/c1-3-4-9-7-10(12)5-6-11(9)16(13)8-15-14-2/h3-8H,2,13H2,1H3/b4-3+,15-8- |
| InChIKey | BGXKSGZTZJXQOF-ZMPAYETISA-N |
| XLogP | 2.70 |
| TPSA | 53.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.71 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|