About hydroxymethanone;tripropylsulfanium
hydroxymethanone;tripropylsulfanium (PubChem CID 88584764) has the molecular formula C10H22O2S
and a molecular weight of 206.35 g/mol. Its IUPAC name is hydroxymethanone;tripropylsulfanium.
Molecular Properties
| Compound Name | hydroxymethanone;tripropylsulfanium |
| PubChem CID | 88584764 |
| Molecular Formula | C10H22O2S |
| Molecular Weight | 206.35 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | hydroxymethanone;tripropylsulfanium |
| SMILES | CCC[S+](CCC)CCC.O=[C-]O |
| InChI | InChI=1S/C9H21S.CHO2/c1-4-7-10(8-5-2)9-6-3;2-1-3/h4-9H2,1-3H3;(H,2,3)/q+1;-1 |
| InChIKey | UWVLCNXKDROQNE-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.35 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze hydroxymethanone;tripropylsulfanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydroxymethanone;tripropylsulfanium?
The IUPAC name of hydroxymethanone;tripropylsulfanium (CID 88584764) is hydroxymethanone;tripropylsulfanium.
What is the SMILES notation for hydroxymethanone;tripropylsulfanium?
The canonical SMILES for hydroxymethanone;tripropylsulfanium is CCC[S+](CCC)CCC.O=[C-]O.
What is the InChIKey of hydroxymethanone;tripropylsulfanium?
The InChIKey is UWVLCNXKDROQNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H21S.CHO2/c1-4-7-10(8-5-2)9-6-3;2-1-3/h4-9H2,1-3H3;(H,2,3)/q+1;-1.
What are the key properties of hydroxymethanone;tripropylsulfanium?
hydroxymethanone;tripropylsulfanium has a molecular weight of 206.35 g/mol, XLogP of 2.45, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for hydroxymethanone;tripropylsulfanium is sourced from PubChem (CID 88584764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).