About 2-hydroxy-2-oxoacetate;tripropylsulfanium
2-hydroxy-2-oxoacetate;tripropylsulfanium (PubChem CID 173028379) has the molecular formula C11H22O4S
and a molecular weight of 250.36 g/mol. Its IUPAC name is 2-hydroxy-2-oxoacetate;tripropylsulfanium.
Molecular Properties
| Compound Name | 2-hydroxy-2-oxoacetate;tripropylsulfanium |
| PubChem CID | 173028379 |
| Molecular Formula | C11H22O4S |
| Molecular Weight | 250.36 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | 2-hydroxy-2-oxoacetate;tripropylsulfanium |
| SMILES | CCC[S+](CCC)CCC.O=C([O-])C(=O)O |
| InChI | InChI=1S/C9H21S.C2H2O4/c1-4-7-10(8-5-2)9-6-3;3-1(4)2(5)6/h4-9H2,1-3H3;(H,3,4)(H,5,6)/q+1;/p-1 |
| InChIKey | JPRRDOLBFBVYJV-UHFFFAOYSA-M |
| XLogP | 0.66 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.36 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxy-2-oxoacetate;tripropylsulfanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-2-oxoacetate;tripropylsulfanium?
The IUPAC name of 2-hydroxy-2-oxoacetate;tripropylsulfanium (CID 173028379) is 2-hydroxy-2-oxoacetate;tripropylsulfanium.
What is the SMILES notation for 2-hydroxy-2-oxoacetate;tripropylsulfanium?
The canonical SMILES for 2-hydroxy-2-oxoacetate;tripropylsulfanium is CCC[S+](CCC)CCC.O=C([O-])C(=O)O.
What is the InChIKey of 2-hydroxy-2-oxoacetate;tripropylsulfanium?
The InChIKey is JPRRDOLBFBVYJV-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H21S.C2H2O4/c1-4-7-10(8-5-2)9-6-3;3-1(4)2(5)6/h4-9H2,1-3H3;(H,3,4)(H,5,6)/q+1;/p-1.
What are the key properties of 2-hydroxy-2-oxoacetate;tripropylsulfanium?
2-hydroxy-2-oxoacetate;tripropylsulfanium has a molecular weight of 250.36 g/mol, XLogP of 0.66, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-2-oxoacetate;tripropylsulfanium is sourced from PubChem (CID 173028379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).