C17H22F3NO7S — CID 88584983
methyl 3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfonyloxy-4-(2,4,5-trifluorophenyl)butanoate (PubChem CID 88584983) has the molecular formula C17H22F3NO7S and a molecular weight of 441.42 g/mol. Its IUPAC name is methyl 3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfonyloxy-4-(2,4,5-trifluorophenyl)butanoate.
| Compound Name | methyl 3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfonyloxy-4-(2,4,5-trifluorophenyl)butanoate |
|---|---|
| PubChem CID | 88584983 |
| Molecular Formula | C17H22F3NO7S |
| Molecular Weight | 441.42 g/mol |
| Exact Mass | 441.11 |
| IUPAC Name | methyl 3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfonyloxy-4-(2,4,5-trifluorophenyl)butanoate |
| SMILES | COC(=O)CC(NC(=O)OC(C)(C)C)C(OS(C)(=O)=O)c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C17H22F3NO7S/c1-17(2,3)27-16(23)21-13(8-14(22)26-4)15(28-29(5,24)25)9-6-11(19)12(20)7-10(9)18/h6-7,13,15H,8H2,1-5H3,(H,21,23) |
| InChIKey | OJULHSVETLUHIU-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.42 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|