C12H12ClNO3S — CID 88585926
2-amino-3-(5-chloro-1-methylidene-1-oxo-1-benzothiophen-3-yl)propanoic acid (PubChem CID 88585926) has the molecular formula C12H12ClNO3S and a molecular weight of 285.75 g/mol. Its IUPAC name is 2-amino-3-(5-chloro-1-methylidene-1-oxo-1-benzothiophen-3-yl)propanoic acid.
| Compound Name | 2-amino-3-(5-chloro-1-methylidene-1-oxo-1-benzothiophen-3-yl)propanoic acid |
|---|---|
| PubChem CID | 88585926 |
| Molecular Formula | C12H12ClNO3S |
| Molecular Weight | 285.75 g/mol |
| Exact Mass | 285.02 |
| IUPAC Name | 2-amino-3-(5-chloro-1-methylidene-1-oxo-1-benzothiophen-3-yl)propanoic acid |
| SMILES | C=S1(=O)C=C(CC(N)C(=O)O)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C12H12ClNO3S/c1-18(17)6-7(4-10(14)12(15)16)9-5-8(13)2-3-11(9)18/h2-3,5-6,10H,1,4,14H2,(H,15,16) |
| InChIKey | GMRIRUQRWZSKBU-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.75 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|