C9H7ClO2S2 — CID 117174579
(5-chloro-1,1-dioxo-1-benzothiophen-3-yl)methanethiol (PubChem CID 117174579) has the molecular formula C9H7ClO2S2 and a molecular weight of 246.74 g/mol. Its IUPAC name is (5-chloro-1,1-dioxo-1-benzothiophen-3-yl)methanethiol.
| Compound Name | (5-chloro-1,1-dioxo-1-benzothiophen-3-yl)methanethiol |
|---|---|
| PubChem CID | 117174579 |
| Molecular Formula | C9H7ClO2S2 |
| Molecular Weight | 246.74 g/mol |
| Exact Mass | 245.96 |
| IUPAC Name | (5-chloro-1,1-dioxo-1-benzothiophen-3-yl)methanethiol |
| SMILES | O=S1(=O)C=C(CS)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C9H7ClO2S2/c10-7-1-2-9-8(3-7)6(4-13)5-14(9,11)12/h1-3,5,13H,4H2 |
| InChIKey | FYKWXSMULOQADG-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 34.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.74 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|