C20H19Cl2FN4O2S — CID 88587657
[2-[(1Z,3E)-1-amino-5-chlorohexa-1,3,5-trien-3-yl]-5-(1H-1,2,4-triazol-5-yl)-2,3-dihydrothiophen-4-yl]-(4-chloro-2-fluoro-5-methoxyphenyl)methanol (PubChem CID 88587657) has the molecular formula C20H19Cl2FN4O2S and a molecular weight of 469.37 g/mol. Its IUPAC name is [2-[(1Z,3E)-1-amino-5-chlorohexa-1,3,5-trien-3-yl]-5-(1H-1,2,4-triazol-5-yl)-2,3-dihydrothiophen-4-yl]-(4-chloro-2-fluoro-5-methoxyphenyl)methanol.
| Compound Name | [2-[(1Z,3E)-1-amino-5-chlorohexa-1,3,5-trien-3-yl]-5-(1H-1,2,4-triazol-5-yl)-2,3-dihydrothiophen-4-yl]-(4-chloro-2-fluoro-5-methoxyphenyl)methanol |
|---|---|
| PubChem CID | 88587657 |
| Molecular Formula | C20H19Cl2FN4O2S |
| Molecular Weight | 469.37 g/mol |
| Exact Mass | 468.06 |
| IUPAC Name | [2-[(1Z,3E)-1-amino-5-chlorohexa-1,3,5-trien-3-yl]-5-(1H-1,2,4-triazol-5-yl)-2,3-dihydrothiophen-4-yl]-(4-chloro-2-fluoro-5-methoxyphenyl)methanol |
| SMILES | C=C(Cl)/C=C(\C=C/N)C1CC(C(O)c2cc(OC)c(Cl)cc2F)=C(c2ncn[nH]2)S1 |
| InChI | InChI=1S/C20H19Cl2FN4O2S/c1-10(21)5-11(3-4-24)17-7-13(19(30-17)20-25-9-26-27-20)18(28)12-6-16(29-2)14(22)8-15(12)23/h3-6,8-9,17-18,28H,1,7,24H2,2H3,(H,25,26,27)/b4-3-,11-5+ |
| InChIKey | XRYLOBLONRFOBV-LDTZZKCISA-N |
| XLogP | 4.71 |
| TPSA | 97.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.37 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|