C20H19FN4OS — CID 88587675
[5-[(1Z,3E)-1-aminohexa-1,3,5-trien-3-yl]-2-(1H-1,2,4-triazol-5-yl)thiophen-3-yl]-(2-fluoro-5-methylphenyl)methanol (PubChem CID 88587675) has the molecular formula C20H19FN4OS and a molecular weight of 382.46 g/mol. Its IUPAC name is [5-[(1Z,3E)-1-aminohexa-1,3,5-trien-3-yl]-2-(1H-1,2,4-triazol-5-yl)thiophen-3-yl]-(2-fluoro-5-methylphenyl)methanol.
| Compound Name | [5-[(1Z,3E)-1-aminohexa-1,3,5-trien-3-yl]-2-(1H-1,2,4-triazol-5-yl)thiophen-3-yl]-(2-fluoro-5-methylphenyl)methanol |
|---|---|
| PubChem CID | 88587675 |
| Molecular Formula | C20H19FN4OS |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | [5-[(1Z,3E)-1-aminohexa-1,3,5-trien-3-yl]-2-(1H-1,2,4-triazol-5-yl)thiophen-3-yl]-(2-fluoro-5-methylphenyl)methanol |
| SMILES | C=C/C=C(\C=C/N)c1cc(C(O)c2cc(C)ccc2F)c(-c2ncn[nH]2)s1 |
| InChI | InChI=1S/C20H19FN4OS/c1-3-4-13(7-8-22)17-10-15(19(27-17)20-23-11-24-25-20)18(26)14-9-12(2)5-6-16(14)21/h3-11,18,26H,1,22H2,2H3,(H,23,24,25)/b8-7-,13-4+ |
| InChIKey | XUPFHPMKIOZKFB-MUMAOQJLSA-N |
| XLogP | 4.10 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|