C12H24N2O2 — CID 88590232
tert-butyl N-[2-methyl-3-(methylaminomethyl)but-3-en-2-yl]carbamate (PubChem CID 88590232) has the molecular formula C12H24N2O2 and a molecular weight of 228.34 g/mol. Its IUPAC name is tert-butyl N-[2-methyl-3-(methylaminomethyl)but-3-en-2-yl]carbamate.
| Compound Name | tert-butyl N-[2-methyl-3-(methylaminomethyl)but-3-en-2-yl]carbamate |
|---|---|
| PubChem CID | 88590232 |
| Molecular Formula | C12H24N2O2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.18 |
| IUPAC Name | tert-butyl N-[2-methyl-3-(methylaminomethyl)but-3-en-2-yl]carbamate |
| SMILES | C=C(CNC)C(C)(C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H24N2O2/c1-9(8-13-7)12(5,6)14-10(15)16-11(2,3)4/h13H,1,8H2,2-7H3,(H,14,15) |
| InChIKey | LPXCTWLZQKYWPH-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|