C9H20ClN3O2 — CID 114996576
[1-amino-2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propylidene]azanium chloride (PubChem CID 114996576) has the molecular formula C9H20ClN3O2 and a molecular weight of 237.73 g/mol. Its IUPAC name is [1-amino-2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propylidene]azanium chloride.
| Compound Name | [1-amino-2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propylidene]azanium chloride |
|---|---|
| PubChem CID | 114996576 |
| Molecular Formula | C9H20ClN3O2 |
| Molecular Weight | 237.73 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | [1-amino-2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propylidene]azanium chloride |
| SMILES | CC(C)(C)OC(=O)NC(C)(C)C(N)=[NH2+].[Cl-] |
| InChI | InChI=1S/C9H19N3O2.ClH/c1-8(2,3)14-7(13)12-9(4,5)6(10)11;/h1-5H3,(H3,10,11)(H,12,13);1H |
| InChIKey | MQPSDWKYJMKWEG-UHFFFAOYSA-N |
| XLogP | -3.59 |
| TPSA | 89.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.73 |
| LogP ≤ 5 | -3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|