C50H43NO4 — CID 88591903
N-[(2S,3R)-3-hydroxy-7,7-dimethyl-1-[(2S,4S,5R)-3,4,5-tris(ethenyl)-6-prop-2-enyloxan-2-yl]oxyoctan-2-yl]hexacosa-2,4,6,8,10,12,14,16,18,20,22,24-dodecaynamide (PubChem CID 88591903) has the molecular formula C50H43NO4 and a molecular weight of 721.90 g/mol. Its IUPAC name is N-[(2S,3R)-3-hydroxy-7,7-dimethyl-1-[(2S,4S,5R)-3,4,5-tris(ethenyl)-6-prop-2-enyloxan-2-yl]oxyoctan-2-yl]hexacosa-2,4,6,8,10,12,14,16,18,20,22,24-dodecaynamide.
| Compound Name | N-[(2S,3R)-3-hydroxy-7,7-dimethyl-1-[(2S,4S,5R)-3,4,5-tris(ethenyl)-6-prop-2-enyloxan-2-yl]oxyoctan-2-yl]hexacosa-2,4,6,8,10,12,14,16,18,20,22,24-dodecaynamide |
|---|---|
| PubChem CID | 88591903 |
| Molecular Formula | C50H43NO4 |
| Molecular Weight | 721.90 g/mol |
| Exact Mass | 721.32 |
| IUPAC Name | N-[(2S,3R)-3-hydroxy-7,7-dimethyl-1-[(2S,4S,5R)-3,4,5-tris(ethenyl)-6-prop-2-enyloxan-2-yl]oxyoctan-2-yl]hexacosa-2,4,6,8,10,12,14,16,18,20,22,24-dodecaynamide |
| SMILES | C=CCC1O[C@H](OC[C@H](NC(=O)C#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC)[C@H](O)CCCC(C)(C)C)C(C=C)[C@@H](C=C)[C@H]1C=C |
| InChI | InChI=1S/C50H43NO4/c1-9-14-15-16-17-18-19-20-21-22-23-24-25-26-27-28-29-30-31-32-33-34-35-39-48(53)51-45(46(52)38-36-40-50(6,7)8)41-54-49-44(13-5)42(11-3)43(12-4)47(55-49)37-10-2/h10-13,42-47,49,52H,2-5,36-38,40-41H2,1,6-8H3,(H,51,53)/t42-,43+,44?,45-,46+,47?,49-/m0/s1 |
| InChIKey | LZACJQMOXOPABA-MEKZWEJPSA-N |
| XLogP | 4.83 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 55 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.90 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|