C11H22O3 — CID 88592568
2,3,3,5,5-pentamethylhexaneperoxoic acid (PubChem CID 88592568) has the molecular formula C11H22O3 and a molecular weight of 202.29 g/mol. Its IUPAC name is 2,3,3,5,5-pentamethylhexaneperoxoic acid.
| Compound Name | 2,3,3,5,5-pentamethylhexaneperoxoic acid |
|---|---|
| PubChem CID | 88592568 |
| Molecular Formula | C11H22O3 |
| Molecular Weight | 202.29 g/mol |
| Exact Mass | 202.16 |
| IUPAC Name | 2,3,3,5,5-pentamethylhexaneperoxoic acid |
| SMILES | CC(C(=O)OO)C(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C11H22O3/c1-8(9(12)14-13)11(5,6)7-10(2,3)4/h8,13H,7H2,1-6H3 |
| InChIKey | NAYGXZJQSHCESW-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.29 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|