C8H14F2O5 — CID 88593421
[(2R,3S,4S,5R)-1,2-difluoro-4,5-dihydroxyhexan-3-yl] ethaneperoxoate (PubChem CID 88593421) has the molecular formula C8H14F2O5 and a molecular weight of 228.19 g/mol. Its IUPAC name is [(2R,3S,4S,5R)-1,2-difluoro-4,5-dihydroxyhexan-3-yl] ethaneperoxoate.
| Compound Name | [(2R,3S,4S,5R)-1,2-difluoro-4,5-dihydroxyhexan-3-yl] ethaneperoxoate |
|---|---|
| PubChem CID | 88593421 |
| Molecular Formula | C8H14F2O5 |
| Molecular Weight | 228.19 g/mol |
| Exact Mass | 228.08 |
| IUPAC Name | [(2R,3S,4S,5R)-1,2-difluoro-4,5-dihydroxyhexan-3-yl] ethaneperoxoate |
| SMILES | CC(=O)OO[C@@H]([C@@H](O)[C@@H](C)O)[C@@H](F)CF |
| InChI | InChI=1S/C8H14F2O5/c1-4(11)7(13)8(6(10)3-9)15-14-5(2)12/h4,6-8,11,13H,3H2,1-2H3/t4-,6+,7+,8-/m1/s1 |
| InChIKey | VMRPWGDMGXXVDR-YDKYIBAVSA-N |
| XLogP | -0.10 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.19 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|