About (4-hydroxy-2,5-dimethylhexan-3-yl) acetate
(4-hydroxy-2,5-dimethylhexan-3-yl) acetate (PubChem CID 172559655) has the molecular formula C10H20O3
and a molecular weight of 188.27 g/mol. Its IUPAC name is (4-hydroxy-2,5-dimethylhexan-3-yl) acetate.
Molecular Properties
| Compound Name | (4-hydroxy-2,5-dimethylhexan-3-yl) acetate |
| PubChem CID | 172559655 |
| Molecular Formula | C10H20O3 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.14 |
| IUPAC Name | (4-hydroxy-2,5-dimethylhexan-3-yl) acetate |
| SMILES | CC(=O)OC(C(C)C)C(O)C(C)C |
| InChI | InChI=1S/C10H20O3/c1-6(2)9(12)10(7(3)4)13-8(5)11/h6-7,9-10,12H,1-5H3 |
| InChIKey | UDYGOVYQXWUKAC-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4-hydroxy-2,5-dimethylhexan-3-yl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-hydroxy-2,5-dimethylhexan-3-yl) acetate?
The IUPAC name of (4-hydroxy-2,5-dimethylhexan-3-yl) acetate (CID 172559655) is (4-hydroxy-2,5-dimethylhexan-3-yl) acetate.
What is the SMILES notation for (4-hydroxy-2,5-dimethylhexan-3-yl) acetate?
The canonical SMILES for (4-hydroxy-2,5-dimethylhexan-3-yl) acetate is CC(=O)OC(C(C)C)C(O)C(C)C.
What is the InChIKey of (4-hydroxy-2,5-dimethylhexan-3-yl) acetate?
The InChIKey is UDYGOVYQXWUKAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O3/c1-6(2)9(12)10(7(3)4)13-8(5)11/h6-7,9-10,12H,1-5H3.
What are the key properties of (4-hydroxy-2,5-dimethylhexan-3-yl) acetate?
(4-hydroxy-2,5-dimethylhexan-3-yl) acetate has a molecular weight of 188.27 g/mol, XLogP of 1.59, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-hydroxy-2,5-dimethylhexan-3-yl) acetate is sourced from PubChem (CID 172559655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).