C19H29N2OS+ — CID 8859374
2-adamantyl-[(2R)-1-oxo-1-(2-thiophen-2-ylethylamino)propan-2-yl]azanium (PubChem CID 8859374) has the molecular formula C19H29N2OS+ and a molecular weight of 333.52 g/mol. Its IUPAC name is 2-adamantyl-[(2R)-1-oxo-1-(2-thiophen-2-ylethylamino)propan-2-yl]azanium.
| Compound Name | 2-adamantyl-[(2R)-1-oxo-1-(2-thiophen-2-ylethylamino)propan-2-yl]azanium |
|---|---|
| PubChem CID | 8859374 |
| Molecular Formula | C19H29N2OS+ |
| Molecular Weight | 333.52 g/mol |
| Exact Mass | 333.20 |
| IUPAC Name | 2-adamantyl-[(2R)-1-oxo-1-(2-thiophen-2-ylethylamino)propan-2-yl]azanium |
| SMILES | C[C@@H]([NH2+]C1C2CC3CC(C2)CC1C3)C(=O)NCCc1cccs1 |
| InChI | InChI=1S/C19H28N2OS/c1-12(19(22)20-5-4-17-3-2-6-23-17)21-18-15-8-13-7-14(10-15)11-16(18)9-13/h2-3,6,12-16,18,21H,4-5,7-11H2,1H3,(H,20,22)/p+1/t12-,13?,14?,15?,16?,18?/m1/s1 |
| InChIKey | DJUGREAOYXKUGX-XKMJEZSVSA-O |
| XLogP | 2.18 |
| TPSA | 45.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.52 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |