C16H26BrNO4 — CID 88595596
2-[(3-bromo-4-methoxyphenyl)methylamino]acetaldehyde;1,1-diethoxyethane (PubChem CID 88595596) has the molecular formula C16H26BrNO4 and a molecular weight of 376.29 g/mol. Its IUPAC name is 2-[(3-bromo-4-methoxyphenyl)methylamino]acetaldehyde;1,1-diethoxyethane.
| Compound Name | 2-[(3-bromo-4-methoxyphenyl)methylamino]acetaldehyde;1,1-diethoxyethane |
|---|---|
| PubChem CID | 88595596 |
| Molecular Formula | C16H26BrNO4 |
| Molecular Weight | 376.29 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | 2-[(3-bromo-4-methoxyphenyl)methylamino]acetaldehyde;1,1-diethoxyethane |
| SMILES | CCOC(C)OCC.COc1ccc(CNCC=O)cc1Br |
| InChI | InChI=1S/C10H12BrNO2.C6H14O2/c1-14-10-3-2-8(6-9(10)11)7-12-4-5-13;1-4-7-6(3)8-5-2/h2-3,5-6,12H,4,7H2,1H3;6H,4-5H2,1-3H3 |
| InChIKey | VYTLOMXTCSNJPZ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.29 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|