C16H24O4S — CID 88597348
[(4S)-3-methyl-1-oxooctan-4-yl] 4-methylbenzenesulfonate (PubChem CID 88597348) has the molecular formula C16H24O4S and a molecular weight of 312.43 g/mol. Its IUPAC name is [(4S)-3-methyl-1-oxooctan-4-yl] 4-methylbenzenesulfonate.
| Compound Name | [(4S)-3-methyl-1-oxooctan-4-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 88597348 |
| Molecular Formula | C16H24O4S |
| Molecular Weight | 312.43 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | [(4S)-3-methyl-1-oxooctan-4-yl] 4-methylbenzenesulfonate |
| SMILES | CCCC[C@H](OS(=O)(=O)c1ccc(C)cc1)C(C)CC=O |
| InChI | InChI=1S/C16H24O4S/c1-4-5-6-16(14(3)11-12-17)20-21(18,19)15-9-7-13(2)8-10-15/h7-10,12,14,16H,4-6,11H2,1-3H3/t14?,16-/m0/s1 |
| InChIKey | XKWQUMXZVGMXAT-WMCAAGNKSA-N |
| XLogP | 3.48 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.43 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|