C22H26O3S — CID 10948667
1-phenylnona-1,2-dien-5-yl 4-methylbenzenesulfonate (PubChem CID 10948667) has the molecular formula C22H26O3S and a molecular weight of 370.51 g/mol. Its IUPAC name is 1-phenylnona-1,2-dien-5-yl 4-methylbenzenesulfonate.
| Compound Name | 1-phenylnona-1,2-dien-5-yl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 10948667 |
| Molecular Formula | C22H26O3S |
| Molecular Weight | 370.51 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | 1-phenylnona-1,2-dien-5-yl 4-methylbenzenesulfonate |
| SMILES | CCCCC(CC=C=Cc1ccccc1)OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C22H26O3S/c1-3-4-13-21(14-9-8-12-20-10-6-5-7-11-20)25-26(23,24)22-17-15-19(2)16-18-22/h5-7,9-12,15-18,21H,3-4,13-14H2,1-2H3 |
| InChIKey | JTBHFQTZBWJQAO-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.51 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|