C31H51Br3O5S — CID 158723330
bis((4R)-2-bromooct-1-en-4-ol);[(4R)-2-bromooct-1-en-4-yl] 4-methylbenzenesulfonate (PubChem CID 158723330) has the molecular formula C31H51Br3O5S and a molecular weight of 775.52 g/mol. Its IUPAC name is bis((4R)-2-bromooct-1-en-4-ol);[(4R)-2-bromooct-1-en-4-yl] 4-methylbenzenesulfonate.
| Compound Name | bis((4R)-2-bromooct-1-en-4-ol);[(4R)-2-bromooct-1-en-4-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 158723330 |
| Molecular Formula | C31H51Br3O5S |
| Molecular Weight | 775.52 g/mol |
| Exact Mass | 772.10 |
| IUPAC Name | bis((4R)-2-bromooct-1-en-4-ol);[(4R)-2-bromooct-1-en-4-yl] 4-methylbenzenesulfonate |
| SMILES | C=C(Br)C[C@@H](CCCC)OS(=O)(=O)c1ccc(C)cc1.C=C(Br)C[C@H](O)CCCC.C=C(Br)C[C@H](O)CCCC |
| InChI | InChI=1S/C15H21BrO3S.2C8H15BrO/c1-4-5-6-14(11-13(3)16)19-20(17,18)15-9-7-12(2)8-10-15;2*1-3-4-5-8(10)6-7(2)9/h7-10,14H,3-6,11H2,1-2H3;2*8,10H,2-6H2,1H3/t14-;2*8-/m111/s1 |
| InChIKey | IKEMNXUIXYZFTF-KOERGFSVSA-N |
| XLogP | 10.23 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 775.52 |
| LogP ≤ 5 | 10.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|