About bis((4R)-2-bromooct-1-en-4-ol);[(4R)-2-bromooct-1-en-4-yl] 4-methylbenzenesulfonate
bis((4R)-2-bromooct-1-en-4-ol);[(4R)-2-bromooct-1-en-4-yl] 4-methylbenzenesulfonate (PubChem CID 158723330) has the molecular formula C31H51Br3O5S
and a molecular weight of 775.52 g/mol. Its IUPAC name is bis((4R)-2-bromooct-1-en-4-ol);[(4R)-2-bromooct-1-en-4-yl] 4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | bis((4R)-2-bromooct-1-en-4-ol);[(4R)-2-bromooct-1-en-4-yl] 4-methylbenzenesulfonate |
| PubChem CID | 158723330 |
| Molecular Formula | C31H51Br3O5S |
| Molecular Weight | 775.52 g/mol |
| Exact Mass | 772.10 |
| IUPAC Name | bis((4R)-2-bromooct-1-en-4-ol);[(4R)-2-bromooct-1-en-4-yl] 4-methylbenzenesulfonate |
| SMILES | C=C(Br)C[C@@H](CCCC)OS(=O)(=O)c1ccc(C)cc1.C=C(Br)C[C@H](O)CCCC.C=C(Br)C[C@H](O)CCCC |
| InChI | InChI=1S/C15H21BrO3S.2C8H15BrO/c1-4-5-6-14(11-13(3)16)19-20(17,18)15-9-7-12(2)8-10-15;2*1-3-4-5-8(10)6-7(2)9/h7-10,14H,3-6,11H2,1-2H3;2*8,10H,2-6H2,1H3/t14-;2*8-/m111/s1 |
| InChIKey | IKEMNXUIXYZFTF-KOERGFSVSA-N |
| XLogP | 10.23 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 775.52 |
| LogP ≤ 5 | 10.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze bis((4R)-2-bromooct-1-en-4-ol);[(4R)-2-bromooct-1-en-4-yl] 4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis((4R)-2-bromooct-1-en-4-ol);[(4R)-2-bromooct-1-en-4-yl] 4-methylbenzenesulfonate?
The IUPAC name of bis((4R)-2-bromooct-1-en-4-ol);[(4R)-2-bromooct-1-en-4-yl] 4-methylbenzenesulfonate (CID 158723330) is bis((4R)-2-bromooct-1-en-4-ol);[(4R)-2-bromooct-1-en-4-yl] 4-methylbenzenesulfonate.
What is the SMILES notation for bis((4R)-2-bromooct-1-en-4-ol);[(4R)-2-bromooct-1-en-4-yl] 4-methylbenzenesulfonate?
The canonical SMILES for bis((4R)-2-bromooct-1-en-4-ol);[(4R)-2-bromooct-1-en-4-yl] 4-methylbenzenesulfonate is C=C(Br)C[C@@H](CCCC)OS(=O)(=O)c1ccc(C)cc1.C=C(Br)C[C@H](O)CCCC.C=C(Br)C[C@H](O)CCCC.
What is the InChIKey of bis((4R)-2-bromooct-1-en-4-ol);[(4R)-2-bromooct-1-en-4-yl] 4-methylbenzenesulfonate?
The InChIKey is IKEMNXUIXYZFTF-KOERGFSVSA-N. The full InChI is InChI=1S/C15H21BrO3S.2C8H15BrO/c1-4-5-6-14(11-13(3)16)19-20(17,18)15-9-7-12(2)8-10-15;2*1-3-4-5-8(10)6-7(2)9/h7-10,14H,3-6,11H2,1-2H3;2*8,10H,2-6H2,1H3/t14-;2*8-/m111/s1.
What are the key properties of bis((4R)-2-bromooct-1-en-4-ol);[(4R)-2-bromooct-1-en-4-yl] 4-methylbenzenesulfonate?
bis((4R)-2-bromooct-1-en-4-ol);[(4R)-2-bromooct-1-en-4-yl] 4-methylbenzenesulfonate has a molecular weight of 775.52 g/mol, XLogP of 10.23, 18 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for bis((4R)-2-bromooct-1-en-4-ol);[(4R)-2-bromooct-1-en-4-yl] 4-methylbenzenesulfonate is sourced from PubChem (CID 158723330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).