C22H31NO — CID 88601549
3-[(1S,3E,5Z)-1-hydroxypentadeca-3,5-dienyl]benzonitrile (PubChem CID 88601549) has the molecular formula C22H31NO and a molecular weight of 325.50 g/mol. Its IUPAC name is 3-[(1S,3E,5Z)-1-hydroxypentadeca-3,5-dienyl]benzonitrile.
| Compound Name | 3-[(1S,3E,5Z)-1-hydroxypentadeca-3,5-dienyl]benzonitrile |
|---|---|
| PubChem CID | 88601549 |
| Molecular Formula | C22H31NO |
| Molecular Weight | 325.50 g/mol |
| Exact Mass | 325.24 |
| IUPAC Name | 3-[(1S,3E,5Z)-1-hydroxypentadeca-3,5-dienyl]benzonitrile |
| SMILES | CCCCCCCCC/C=C\C=C\C[C@H](O)c1cccc(C#N)c1 |
| InChI | InChI=1S/C22H31NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-17-22(24)21-16-14-15-20(18-21)19-23/h10-16,18,22,24H,2-9,17H2,1H3/b11-10-,13-12+/t22-/m0/s1 |
| InChIKey | BQWQYIQPKSSFRW-REDFWKSISA-N |
| XLogP | 6.23 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.50 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|