C8H18NO3PS3 — CID 88601790
3-dihydroxyphosphinothioylsulfanyl-2-ethylsulfanyl-N,2-dimethylbutanamide (PubChem CID 88601790) has the molecular formula C8H18NO3PS3 and a molecular weight of 303.41 g/mol. Its IUPAC name is 3-dihydroxyphosphinothioylsulfanyl-2-ethylsulfanyl-N,2-dimethylbutanamide.
| Compound Name | 3-dihydroxyphosphinothioylsulfanyl-2-ethylsulfanyl-N,2-dimethylbutanamide |
|---|---|
| PubChem CID | 88601790 |
| Molecular Formula | C8H18NO3PS3 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.02 |
| IUPAC Name | 3-dihydroxyphosphinothioylsulfanyl-2-ethylsulfanyl-N,2-dimethylbutanamide |
| SMILES | CCSC(C)(C(=O)NC)C(C)SP(O)(O)=S |
| InChI | InChI=1S/C8H18NO3PS3/c1-5-15-8(3,7(10)9-4)6(2)16-13(11,12)14/h6H,5H2,1-4H3,(H,9,10)(H2,11,12,14) |
| InChIKey | JWFPCSQNWREBOF-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|