C54H64N4O10 — CID 88603112
bis[5,8-dimethoxy-2-[[1-(3-methylbenzoyl)piperidin-4-yl]methyl]-3,4-dihydro-1H-isoquinolin-1-yl] (E)-but-2-enedioate (PubChem CID 88603112) has the molecular formula C54H64N4O10 and a molecular weight of 929.12 g/mol. Its IUPAC name is bis[5,8-dimethoxy-2-[[1-(3-methylbenzoyl)piperidin-4-yl]methyl]-3,4-dihydro-1H-isoquinolin-1-yl] (E)-but-2-enedioate.
| Compound Name | bis[5,8-dimethoxy-2-[[1-(3-methylbenzoyl)piperidin-4-yl]methyl]-3,4-dihydro-1H-isoquinolin-1-yl] (E)-but-2-enedioate |
|---|---|
| PubChem CID | 88603112 |
| Molecular Formula | C54H64N4O10 |
| Molecular Weight | 929.12 g/mol |
| Exact Mass | 928.46 |
| IUPAC Name | bis[5,8-dimethoxy-2-[[1-(3-methylbenzoyl)piperidin-4-yl]methyl]-3,4-dihydro-1H-isoquinolin-1-yl] (E)-but-2-enedioate |
| SMILES | COc1ccc(OC)c2c1CCN(CC1CCN(C(=O)c3cccc(C)c3)CC1)C2OC(=O)/C=C/C(=O)OC1c2c(OC)ccc(OC)c2CCN1CC1CCN(C(=O)c2cccc(C)c2)CC1 |
| InChI | InChI=1S/C54H64N4O10/c1-35-9-7-11-39(31-35)51(61)55-25-19-37(20-26-55)33-57-29-23-41-43(63-3)13-15-45(65-5)49(41)53(57)67-47(59)17-18-48(60)68-54-50-42(44(64-4)14-16-46(50)66-6)24-30-58(54)34-38-21-27-56(28-22-38)52(62)40-12-8-10-36(2)32-40/h7-18,31-32,37-38,53-54H,19-30,33-34H2,1-6H3/b18-17+ |
| InChIKey | RGFSAAUUXPHONO-ISLYRVAYSA-N |
| XLogP | 7.50 |
| TPSA | 136.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 68 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 929.12 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|