About cobalt;bis(2-[propylamino-(2-propylhydrazinyl)methyl]phenol)
cobalt;bis(2-[propylamino-(2-propylhydrazinyl)methyl]phenol) (PubChem CID 88606230) has the molecular formula C26H46CoN6O2
and a molecular weight of 533.63 g/mol. Its IUPAC name is cobalt;bis(2-[propylamino-(2-propylhydrazinyl)methyl]phenol).
Molecular Properties
| Compound Name | cobalt;bis(2-[propylamino-(2-propylhydrazinyl)methyl]phenol) |
| PubChem CID | 88606230 |
| Molecular Formula | C26H46CoN6O2 |
| Molecular Weight | 533.63 g/mol |
| Exact Mass | 533.30 |
| IUPAC Name | cobalt;bis(2-[propylamino-(2-propylhydrazinyl)methyl]phenol) |
| SMILES | CCCNNC(NCCC)c1ccccc1O.CCCNNC(NCCC)c1ccccc1O.[Co] |
| InChI | InChI=1S/2C13H23N3O.Co/c2*1-3-9-14-13(16-15-10-4-2)11-7-5-6-8-12(11)17;/h2*5-8,13-17H,3-4,9-10H2,1-2H3; |
| InChIKey | DNNTYUJIXOYMDU-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 112.64 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 533.63 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze cobalt;bis(2-[propylamino-(2-propylhydrazinyl)methyl]phenol) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cobalt;bis(2-[propylamino-(2-propylhydrazinyl)methyl]phenol)?
The IUPAC name of cobalt;bis(2-[propylamino-(2-propylhydrazinyl)methyl]phenol) (CID 88606230) is cobalt;bis(2-[propylamino-(2-propylhydrazinyl)methyl]phenol).
What is the SMILES notation for cobalt;bis(2-[propylamino-(2-propylhydrazinyl)methyl]phenol)?
The canonical SMILES for cobalt;bis(2-[propylamino-(2-propylhydrazinyl)methyl]phenol) is CCCNNC(NCCC)c1ccccc1O.CCCNNC(NCCC)c1ccccc1O.[Co].
What is the InChIKey of cobalt;bis(2-[propylamino-(2-propylhydrazinyl)methyl]phenol)?
The InChIKey is DNNTYUJIXOYMDU-UHFFFAOYSA-N. The full InChI is InChI=1S/2C13H23N3O.Co/c2*1-3-9-14-13(16-15-10-4-2)11-7-5-6-8-12(11)17;/h2*5-8,13-17H,3-4,9-10H2,1-2H3;.
What are the key properties of cobalt;bis(2-[propylamino-(2-propylhydrazinyl)methyl]phenol)?
cobalt;bis(2-[propylamino-(2-propylhydrazinyl)methyl]phenol) has a molecular weight of 533.63 g/mol, XLogP of 3.79, 16 rotatable bonds, 8 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for cobalt;bis(2-[propylamino-(2-propylhydrazinyl)methyl]phenol) is sourced from PubChem (CID 88606230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).