C18H26N2O6P2 — CID 23422856
[[2-[[[hydroxy(methyl)phosphoryl]-(2-hydroxyphenyl)methyl]amino]ethylamino]-(2-hydroxyphenyl)methyl]-methylphosphinic acid (PubChem CID 23422856) has the molecular formula C18H26N2O6P2 and a molecular weight of 428.36 g/mol. Its IUPAC name is [[2-[[[hydroxy(methyl)phosphoryl]-(2-hydroxyphenyl)methyl]amino]ethylamino]-(2-hydroxyphenyl)methyl]-methylphosphinic acid.
| Compound Name | [[2-[[[hydroxy(methyl)phosphoryl]-(2-hydroxyphenyl)methyl]amino]ethylamino]-(2-hydroxyphenyl)methyl]-methylphosphinic acid |
|---|---|
| PubChem CID | 23422856 |
| Molecular Formula | C18H26N2O6P2 |
| Molecular Weight | 428.36 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | [[2-[[[hydroxy(methyl)phosphoryl]-(2-hydroxyphenyl)methyl]amino]ethylamino]-(2-hydroxyphenyl)methyl]-methylphosphinic acid |
| SMILES | CP(=O)(O)C(NCCNC(c1ccccc1O)P(C)(=O)O)c1ccccc1O |
| InChI | InChI=1S/C18H26N2O6P2/c1-27(23,24)17(13-7-3-5-9-15(13)21)19-11-12-20-18(28(2,25)26)14-8-4-6-10-16(14)22/h3-10,17-22H,11-12H2,1-2H3,(H,23,24)(H,25,26) |
| InChIKey | KIIKWJXXKCWZIZ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 139.12 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.36 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|