C13H20O6S — CID 88606889
ethoxyethane;(2-prop-2-enylphenoxy) hydrogen sulfate (PubChem CID 88606889) has the molecular formula C13H20O6S and a molecular weight of 304.36 g/mol. Its IUPAC name is ethoxyethane;(2-prop-2-enylphenoxy) hydrogen sulfate.
| Compound Name | ethoxyethane;(2-prop-2-enylphenoxy) hydrogen sulfate |
|---|---|
| PubChem CID | 88606889 |
| Molecular Formula | C13H20O6S |
| Molecular Weight | 304.36 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | ethoxyethane;(2-prop-2-enylphenoxy) hydrogen sulfate |
| SMILES | C=CCc1ccccc1OOS(=O)(=O)O.CCOCC |
| InChI | InChI=1S/C9H10O5S.C4H10O/c1-2-5-8-6-3-4-7-9(8)13-14-15(10,11)12;1-3-5-4-2/h2-4,6-7H,1,5H2,(H,10,11,12);3-4H2,1-2H3 |
| InChIKey | OQTQHEMQSPFXHV-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.36 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|