C7H12N2O6 — CID 88607946
2-[bis(carboxymethyl)amino]-2-(methylamino)acetic acid (PubChem CID 88607946) has the molecular formula C7H12N2O6 and a molecular weight of 220.18 g/mol. Its IUPAC name is 2-[bis(carboxymethyl)amino]-2-(methylamino)acetic acid.
| Compound Name | 2-[bis(carboxymethyl)amino]-2-(methylamino)acetic acid |
|---|---|
| PubChem CID | 88607946 |
| Molecular Formula | C7H12N2O6 |
| Molecular Weight | 220.18 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | 2-[bis(carboxymethyl)amino]-2-(methylamino)acetic acid |
| SMILES | CNC(C(=O)O)N(CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C7H12N2O6/c1-8-6(7(14)15)9(2-4(10)11)3-5(12)13/h6,8H,2-3H2,1H3,(H,10,11)(H,12,13)(H,14,15) |
| InChIKey | LKAYLEGVPCUZNT-UHFFFAOYSA-N |
| XLogP | -1.91 |
| TPSA | 127.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.18 |
| LogP ≤ 5 | -1.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|