C24H36N2O3 — CID 88608313
N,N-diethylethanamine;N-hydroxy-3-[4-(1-phenylethoxy)phenyl]butanamide (PubChem CID 88608313) has the molecular formula C24H36N2O3 and a molecular weight of 400.56 g/mol. Its IUPAC name is N,N-diethylethanamine;N-hydroxy-3-[4-(1-phenylethoxy)phenyl]butanamide.
| Compound Name | N,N-diethylethanamine;N-hydroxy-3-[4-(1-phenylethoxy)phenyl]butanamide |
|---|---|
| PubChem CID | 88608313 |
| Molecular Formula | C24H36N2O3 |
| Molecular Weight | 400.56 g/mol |
| Exact Mass | 400.27 |
| IUPAC Name | N,N-diethylethanamine;N-hydroxy-3-[4-(1-phenylethoxy)phenyl]butanamide |
| SMILES | CC(CC(=O)NO)c1ccc(OC(C)c2ccccc2)cc1.CCN(CC)CC |
| InChI | InChI=1S/C18H21NO3.C6H15N/c1-13(12-18(20)19-21)15-8-10-17(11-9-15)22-14(2)16-6-4-3-5-7-16;1-4-7(5-2)6-3/h3-11,13-14,21H,12H2,1-2H3,(H,19,20);4-6H2,1-3H3 |
| InChIKey | HLTJKBUEZDPSHS-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.56 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|