C20H25N2O+ — CID 8861097
2-(5-ethyl-2-methylpyridin-1-ium-1-yl)-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]acetamide (PubChem CID 8861097) has the molecular formula C20H25N2O+ and a molecular weight of 309.43 g/mol. Its IUPAC name is 2-(5-ethyl-2-methylpyridin-1-ium-1-yl)-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]acetamide.
| Compound Name | 2-(5-ethyl-2-methylpyridin-1-ium-1-yl)-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]acetamide |
|---|---|
| PubChem CID | 8861097 |
| Molecular Formula | C20H25N2O+ |
| Molecular Weight | 309.43 g/mol |
| Exact Mass | 309.20 |
| IUPAC Name | 2-(5-ethyl-2-methylpyridin-1-ium-1-yl)-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]acetamide |
| SMILES | CCc1ccc(C)[n+](CC(=O)N[C@@H]2CCCc3ccccc32)c1 |
| InChI | InChI=1S/C20H24N2O/c1-3-16-12-11-15(2)22(13-16)14-20(23)21-19-10-6-8-17-7-4-5-9-18(17)19/h4-5,7,9,11-13,19H,3,6,8,10,14H2,1-2H3/p+1/t19-/m1/s1 |
| InChIKey | DPDWQXBEIQIPSI-LJQANCHMSA-O |
| XLogP | 3.04 |
| TPSA | 32.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.43 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|