C21H21N2O+ — CID 8828622
2-isoquinolin-2-ium-2-yl-N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]acetamide (PubChem CID 8828622) has the molecular formula C21H21N2O+ and a molecular weight of 317.41 g/mol. Its IUPAC name is 2-isoquinolin-2-ium-2-yl-N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]acetamide.
| Compound Name | 2-isoquinolin-2-ium-2-yl-N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]acetamide |
|---|---|
| PubChem CID | 8828622 |
| Molecular Formula | C21H21N2O+ |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | 2-isoquinolin-2-ium-2-yl-N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]acetamide |
| SMILES | O=C(C[n+]1ccc2ccccc2c1)N[C@H]1CCCc2ccccc21 |
| InChI | InChI=1S/C21H20N2O/c24-21(15-23-13-12-16-6-1-2-8-18(16)14-23)22-20-11-5-9-17-7-3-4-10-19(17)20/h1-4,6-8,10,12-14,20H,5,9,11,15H2/p+1/t20-/m0/s1 |
| InChIKey | ZSUSUTMXQKZGHT-FQEVSTJZSA-O |
| XLogP | 3.32 |
| TPSA | 32.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|