C17H18N2O4S — CID 75403884
2-(1-oxidopyridin-1-ium-2-yl)sulfonyl-N-(1,2,3,4-tetrahydronaphthalen-1-yl)acetamide (PubChem CID 75403884) has the molecular formula C17H18N2O4S and a molecular weight of 346.41 g/mol. Its IUPAC name is 2-(1-oxidopyridin-1-ium-2-yl)sulfonyl-N-(1,2,3,4-tetrahydronaphthalen-1-yl)acetamide.
| Compound Name | 2-(1-oxidopyridin-1-ium-2-yl)sulfonyl-N-(1,2,3,4-tetrahydronaphthalen-1-yl)acetamide |
|---|---|
| PubChem CID | 75403884 |
| Molecular Formula | C17H18N2O4S |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | 2-(1-oxidopyridin-1-ium-2-yl)sulfonyl-N-(1,2,3,4-tetrahydronaphthalen-1-yl)acetamide |
| SMILES | O=C(CS(=O)(=O)c1cccc[n+]1[O-])NC1CCCc2ccccc21 |
| InChI | InChI=1S/C17H18N2O4S/c20-16(12-24(22,23)17-10-3-4-11-19(17)21)18-15-9-5-7-13-6-1-2-8-14(13)15/h1-4,6,8,10-11,15H,5,7,9,12H2,(H,18,20) |
| InChIKey | YSLLZPGPMHOHQV-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 90.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|