About 1-N-benzoyl-2-N-tert-butyl-2-N'-methoxy-2-N'-(4-methylbenzoyl)ethanedihydrazide
1-N-benzoyl-2-N-tert-butyl-2-N'-methoxy-2-N'-(4-methylbenzoyl)ethanedihydrazide (PubChem CID 88611106) has the molecular formula C22H26N4O5
and a molecular weight of 426.47 g/mol. Its IUPAC name is 1-N-benzoyl-2-N-tert-butyl-2-N'-methoxy-2-N'-(4-methylbenzoyl)ethanedihydrazide.
Molecular Properties
| Compound Name | 1-N-benzoyl-2-N-tert-butyl-2-N'-methoxy-2-N'-(4-methylbenzoyl)ethanedihydrazide |
| PubChem CID | 88611106 |
| Molecular Formula | C22H26N4O5 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | 1-N-benzoyl-2-N-tert-butyl-2-N'-methoxy-2-N'-(4-methylbenzoyl)ethanedihydrazide |
| SMILES | CON(C(=O)c1ccc(C)cc1)N(C(=O)C(=O)N(N)C(=O)c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C22H26N4O5/c1-15-11-13-17(14-12-15)19(28)26(31-5)25(22(2,3)4)21(30)20(29)24(23)18(27)16-9-7-6-8-10-16/h6-14H,23H2,1-5H3 |
| InChIKey | ZUUOJQNBCHSRCA-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 113.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-N-benzoyl-2-N-tert-butyl-2-N'-methoxy-2-N'-(4-methylbenzoyl)ethanedihydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N-benzoyl-2-N-tert-butyl-2-N'-methoxy-2-N'-(4-methylbenzoyl)ethanedihydrazide?
The IUPAC name of 1-N-benzoyl-2-N-tert-butyl-2-N'-methoxy-2-N'-(4-methylbenzoyl)ethanedihydrazide (CID 88611106) is 1-N-benzoyl-2-N-tert-butyl-2-N'-methoxy-2-N'-(4-methylbenzoyl)ethanedihydrazide.
What is the SMILES notation for 1-N-benzoyl-2-N-tert-butyl-2-N'-methoxy-2-N'-(4-methylbenzoyl)ethanedihydrazide?
The canonical SMILES for 1-N-benzoyl-2-N-tert-butyl-2-N'-methoxy-2-N'-(4-methylbenzoyl)ethanedihydrazide is CON(C(=O)c1ccc(C)cc1)N(C(=O)C(=O)N(N)C(=O)c1ccccc1)C(C)(C)C.
What is the InChIKey of 1-N-benzoyl-2-N-tert-butyl-2-N'-methoxy-2-N'-(4-methylbenzoyl)ethanedihydrazide?
The InChIKey is ZUUOJQNBCHSRCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H26N4O5/c1-15-11-13-17(14-12-15)19(28)26(31-5)25(22(2,3)4)21(30)20(29)24(23)18(27)16-9-7-6-8-10-16/h6-14H,23H2,1-5H3.
What are the key properties of 1-N-benzoyl-2-N-tert-butyl-2-N'-methoxy-2-N'-(4-methylbenzoyl)ethanedihydrazide?
1-N-benzoyl-2-N-tert-butyl-2-N'-methoxy-2-N'-(4-methylbenzoyl)ethanedihydrazide has a molecular weight of 426.47 g/mol, XLogP of 2.08, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N-benzoyl-2-N-tert-butyl-2-N'-methoxy-2-N'-(4-methylbenzoyl)ethanedihydrazide is sourced from PubChem (CID 88611106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).