C12H15NO9S3 — CID 88611186
7-amino-8-ethylsulfonylnaphthalene-1-sulfonic acid;sulfuric acid (PubChem CID 88611186) has the molecular formula C12H15NO9S3 and a molecular weight of 413.45 g/mol. Its IUPAC name is 7-amino-8-ethylsulfonylnaphthalene-1-sulfonic acid;sulfuric acid.
| Compound Name | 7-amino-8-ethylsulfonylnaphthalene-1-sulfonic acid;sulfuric acid |
|---|---|
| PubChem CID | 88611186 |
| Molecular Formula | C12H15NO9S3 |
| Molecular Weight | 413.45 g/mol |
| Exact Mass | 412.99 |
| IUPAC Name | 7-amino-8-ethylsulfonylnaphthalene-1-sulfonic acid;sulfuric acid |
| SMILES | CCS(=O)(=O)c1c(N)ccc2cccc(S(=O)(=O)O)c12.O=S(=O)(O)O |
| InChI | InChI=1S/C12H13NO5S2.H2O4S/c1-2-19(14,15)12-9(13)7-6-8-4-3-5-10(11(8)12)20(16,17)18;1-5(2,3)4/h3-7H,2,13H2,1H3,(H,16,17,18);(H2,1,2,3,4) |
| InChIKey | VYCMJRAAVLPUBE-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 189.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.45 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|