C13H19NO — CID 88611694
N-(5,6,7,8-tetrahydronaphthalen-2-yloxy)propan-1-amine (PubChem CID 88611694) has the molecular formula C13H19NO and a molecular weight of 205.30 g/mol. Its IUPAC name is N-(5,6,7,8-tetrahydronaphthalen-2-yloxy)propan-1-amine.
| Compound Name | N-(5,6,7,8-tetrahydronaphthalen-2-yloxy)propan-1-amine |
|---|---|
| PubChem CID | 88611694 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | N-(5,6,7,8-tetrahydronaphthalen-2-yloxy)propan-1-amine |
| SMILES | CCCNOc1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C13H19NO/c1-2-9-14-15-13-8-7-11-5-3-4-6-12(11)10-13/h7-8,10,14H,2-6,9H2,1H3 |
| InChIKey | JEGVXMODVWRHDF-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|