C16H13ClN2 — CID 88612038
6H-isoquinolino[2,1-g][1,6]naphthyridine;hydrochloride (PubChem CID 88612038) has the molecular formula C16H13ClN2 and a molecular weight of 268.75 g/mol. Its IUPAC name is 6H-isoquinolino[2,1-g][1,6]naphthyridine;hydrochloride.
| Compound Name | 6H-isoquinolino[2,1-g][1,6]naphthyridine;hydrochloride |
|---|---|
| PubChem CID | 88612038 |
| Molecular Formula | C16H13ClN2 |
| Molecular Weight | 268.75 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | 6H-isoquinolino[2,1-g][1,6]naphthyridine;hydrochloride |
| SMILES | C1=c2ccccc2=C2C=c3ncccc3=CN2C1.Cl |
| InChI | InChI=1S/C16H12N2.ClH/c1-2-6-14-12(4-1)7-9-18-11-13-5-3-8-17-15(13)10-16(14)18;/h1-8,10-11H,9H2;1H |
| InChIKey | BLQIXLSOSDTIFZ-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.75 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |