C22H19ClN2OS — CID 8861383
1-(4-chlorophenyl)-3-(2-ethylanilino)-2-pyridin-1-ium-1-yl-3-sulfanylideneprop-1-en-1-olate (PubChem CID 8861383) has the molecular formula C22H19ClN2OS and a molecular weight of 394.93 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-(2-ethylanilino)-2-pyridin-1-ium-1-yl-3-sulfanylideneprop-1-en-1-olate.
| Compound Name | 1-(4-chlorophenyl)-3-(2-ethylanilino)-2-pyridin-1-ium-1-yl-3-sulfanylideneprop-1-en-1-olate |
|---|---|
| PubChem CID | 8861383 |
| Molecular Formula | C22H19ClN2OS |
| Molecular Weight | 394.93 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | 1-(4-chlorophenyl)-3-(2-ethylanilino)-2-pyridin-1-ium-1-yl-3-sulfanylideneprop-1-en-1-olate |
| SMILES | CCc1ccccc1NC(=S)C(=C([O-])c1ccc(Cl)cc1)[n+]1ccccc1 |
| InChI | InChI=1S/C22H19ClN2OS/c1-2-16-8-4-5-9-19(16)24-22(27)20(25-14-6-3-7-15-25)21(26)17-10-12-18(23)13-11-17/h3-15H,2H2,1H3,(H-,24,26,27) |
| InChIKey | FGQHAYXKLUEFDG-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 38.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.93 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|