About 2-carboxyoxypropan-2-yl 2-tert-butyl-3-butylperoxybut-2-enoate
2-carboxyoxypropan-2-yl 2-tert-butyl-3-butylperoxybut-2-enoate (PubChem CID 88614029) has the molecular formula C16H28O7
and a molecular weight of 332.39 g/mol. Its IUPAC name is 2-carboxyoxypropan-2-yl 2-tert-butyl-3-butylperoxybut-2-enoate.
Molecular Properties
| Compound Name | 2-carboxyoxypropan-2-yl 2-tert-butyl-3-butylperoxybut-2-enoate |
| PubChem CID | 88614029 |
| Molecular Formula | C16H28O7 |
| Molecular Weight | 332.39 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | 2-carboxyoxypropan-2-yl 2-tert-butyl-3-butylperoxybut-2-enoate |
| SMILES | CCCCOOC(C)=C(C(=O)OC(C)(C)OC(=O)O)C(C)(C)C |
| InChI | InChI=1S/C16H28O7/c1-8-9-10-20-23-11(2)12(15(3,4)5)13(17)21-16(6,7)22-14(18)19/h8-10H2,1-7H3,(H,18,19) |
| InChIKey | ZRIZXTBDOHTMPR-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.39 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-carboxyoxypropan-2-yl 2-tert-butyl-3-butylperoxybut-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-carboxyoxypropan-2-yl 2-tert-butyl-3-butylperoxybut-2-enoate?
The IUPAC name of 2-carboxyoxypropan-2-yl 2-tert-butyl-3-butylperoxybut-2-enoate (CID 88614029) is 2-carboxyoxypropan-2-yl 2-tert-butyl-3-butylperoxybut-2-enoate.
What is the SMILES notation for 2-carboxyoxypropan-2-yl 2-tert-butyl-3-butylperoxybut-2-enoate?
The canonical SMILES for 2-carboxyoxypropan-2-yl 2-tert-butyl-3-butylperoxybut-2-enoate is CCCCOOC(C)=C(C(=O)OC(C)(C)OC(=O)O)C(C)(C)C.
What is the InChIKey of 2-carboxyoxypropan-2-yl 2-tert-butyl-3-butylperoxybut-2-enoate?
The InChIKey is ZRIZXTBDOHTMPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28O7/c1-8-9-10-20-23-11(2)12(15(3,4)5)13(17)21-16(6,7)22-14(18)19/h8-10H2,1-7H3,(H,18,19).
What are the key properties of 2-carboxyoxypropan-2-yl 2-tert-butyl-3-butylperoxybut-2-enoate?
2-carboxyoxypropan-2-yl 2-tert-butyl-3-butylperoxybut-2-enoate has a molecular weight of 332.39 g/mol, XLogP of 4.03, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-carboxyoxypropan-2-yl 2-tert-butyl-3-butylperoxybut-2-enoate is sourced from PubChem (CID 88614029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).