About 2-butylperoxypropan-2-yl hydrogen carbonate;chloro benzenecarboperoxoate
2-butylperoxypropan-2-yl hydrogen carbonate;chloro benzenecarboperoxoate (PubChem CID 174813575) has the molecular formula C15H21ClO8
and a molecular weight of 364.78 g/mol. Its IUPAC name is 2-butylperoxypropan-2-yl hydrogen carbonate;chloro benzenecarboperoxoate.
Molecular Properties
| Compound Name | 2-butylperoxypropan-2-yl hydrogen carbonate;chloro benzenecarboperoxoate |
| PubChem CID | 174813575 |
| Molecular Formula | C15H21ClO8 |
| Molecular Weight | 364.78 g/mol |
| Exact Mass | 364.09 |
| IUPAC Name | 2-butylperoxypropan-2-yl hydrogen carbonate;chloro benzenecarboperoxoate |
| SMILES | CCCCOOC(C)(C)OC(=O)O.O=C(OOCl)c1ccccc1 |
| InChI | InChI=1S/C8H16O5.C7H5ClO3/c1-4-5-6-11-13-8(2,3)12-7(9)10;8-11-10-7(9)6-4-2-1-3-5-6/h4-6H2,1-3H3,(H,9,10);1-5H |
| InChIKey | DINATQZMNBXZIL-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.78 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 2-butylperoxypropan-2-yl hydrogen carbonate;chloro benzenecarboperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butylperoxypropan-2-yl hydrogen carbonate;chloro benzenecarboperoxoate?
The IUPAC name of 2-butylperoxypropan-2-yl hydrogen carbonate;chloro benzenecarboperoxoate (CID 174813575) is 2-butylperoxypropan-2-yl hydrogen carbonate;chloro benzenecarboperoxoate.
What is the SMILES notation for 2-butylperoxypropan-2-yl hydrogen carbonate;chloro benzenecarboperoxoate?
The canonical SMILES for 2-butylperoxypropan-2-yl hydrogen carbonate;chloro benzenecarboperoxoate is CCCCOOC(C)(C)OC(=O)O.O=C(OOCl)c1ccccc1.
What is the InChIKey of 2-butylperoxypropan-2-yl hydrogen carbonate;chloro benzenecarboperoxoate?
The InChIKey is DINATQZMNBXZIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O5.C7H5ClO3/c1-4-5-6-11-13-8(2,3)12-7(9)10;8-11-10-7(9)6-4-2-1-3-5-6/h4-6H2,1-3H3,(H,9,10);1-5H.
What are the key properties of 2-butylperoxypropan-2-yl hydrogen carbonate;chloro benzenecarboperoxoate?
2-butylperoxypropan-2-yl hydrogen carbonate;chloro benzenecarboperoxoate has a molecular weight of 364.78 g/mol, XLogP of 4.09, 8 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butylperoxypropan-2-yl hydrogen carbonate;chloro benzenecarboperoxoate is sourced from PubChem (CID 174813575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).