About butyl benzenecarboperoxoate;2-hydroperoxy-2-(2-hydroperoxybutan-2-ylperoxy)butane
butyl benzenecarboperoxoate;2-hydroperoxy-2-(2-hydroperoxybutan-2-ylperoxy)butane (PubChem CID 88518227) has the molecular formula C19H32O9
and a molecular weight of 404.46 g/mol. Its IUPAC name is butyl benzenecarboperoxoate;2-hydroperoxy-2-(2-hydroperoxybutan-2-ylperoxy)butane.
Molecular Properties
| Compound Name | butyl benzenecarboperoxoate;2-hydroperoxy-2-(2-hydroperoxybutan-2-ylperoxy)butane |
| PubChem CID | 88518227 |
| Molecular Formula | C19H32O9 |
| Molecular Weight | 404.46 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | butyl benzenecarboperoxoate;2-hydroperoxy-2-(2-hydroperoxybutan-2-ylperoxy)butane |
| SMILES | CCC(C)(OO)OOC(C)(CC)OO.CCCCOOC(=O)c1ccccc1 |
| InChI | InChI=1S/C11H14O3.C8H18O6/c1-2-3-9-13-14-11(12)10-7-5-4-6-8-10;1-5-7(3,11-9)13-14-8(4,6-2)12-10/h4-8H,2-3,9H2,1H3;9-10H,5-6H2,1-4H3 |
| InChIKey | NHWUPFPHLFARNS-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 112.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.46 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze butyl benzenecarboperoxoate;2-hydroperoxy-2-(2-hydroperoxybutan-2-ylperoxy)butane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl benzenecarboperoxoate;2-hydroperoxy-2-(2-hydroperoxybutan-2-ylperoxy)butane?
The IUPAC name of butyl benzenecarboperoxoate;2-hydroperoxy-2-(2-hydroperoxybutan-2-ylperoxy)butane (CID 88518227) is butyl benzenecarboperoxoate;2-hydroperoxy-2-(2-hydroperoxybutan-2-ylperoxy)butane.
What is the SMILES notation for butyl benzenecarboperoxoate;2-hydroperoxy-2-(2-hydroperoxybutan-2-ylperoxy)butane?
The canonical SMILES for butyl benzenecarboperoxoate;2-hydroperoxy-2-(2-hydroperoxybutan-2-ylperoxy)butane is CCC(C)(OO)OOC(C)(CC)OO.CCCCOOC(=O)c1ccccc1.
What is the InChIKey of butyl benzenecarboperoxoate;2-hydroperoxy-2-(2-hydroperoxybutan-2-ylperoxy)butane?
The InChIKey is NHWUPFPHLFARNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O3.C8H18O6/c1-2-3-9-13-14-11(12)10-7-5-4-6-8-10;1-5-7(3,11-9)13-14-8(4,6-2)12-10/h4-8H,2-3,9H2,1H3;9-10H,5-6H2,1-4H3.
What are the key properties of butyl benzenecarboperoxoate;2-hydroperoxy-2-(2-hydroperoxybutan-2-ylperoxy)butane?
butyl benzenecarboperoxoate;2-hydroperoxy-2-(2-hydroperoxybutan-2-ylperoxy)butane has a molecular weight of 404.46 g/mol, XLogP of 4.74, 12 rotatable bonds, 2 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for butyl benzenecarboperoxoate;2-hydroperoxy-2-(2-hydroperoxybutan-2-ylperoxy)butane is sourced from PubChem (CID 88518227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).