C13H18O5 — CID 88614427
2-hydroxy-3-[4-[2-(hydroxymethoxy)ethoxy]phenyl]-2-methylpropanal (PubChem CID 88614427) has the molecular formula C13H18O5 and a molecular weight of 254.28 g/mol. Its IUPAC name is 2-hydroxy-3-[4-[2-(hydroxymethoxy)ethoxy]phenyl]-2-methylpropanal.
| Compound Name | 2-hydroxy-3-[4-[2-(hydroxymethoxy)ethoxy]phenyl]-2-methylpropanal |
|---|---|
| PubChem CID | 88614427 |
| Molecular Formula | C13H18O5 |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 2-hydroxy-3-[4-[2-(hydroxymethoxy)ethoxy]phenyl]-2-methylpropanal |
| SMILES | CC(O)(C=O)Cc1ccc(OCCOCO)cc1 |
| InChI | InChI=1S/C13H18O5/c1-13(16,9-14)8-11-2-4-12(5-3-11)18-7-6-17-10-15/h2-5,9,15-16H,6-8,10H2,1H3 |
| InChIKey | OPADNYADMCGSGV-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|