C12H7BrClN3O — CID 88616795
3-bromo-1-chloro-5H-pyrido[4,3-b]indole-4-carboxamide (PubChem CID 88616795) has the molecular formula C12H7BrClN3O and a molecular weight of 324.57 g/mol. Its IUPAC name is 3-bromo-1-chloro-5H-pyrido[4,3-b]indole-4-carboxamide.
| Compound Name | 3-bromo-1-chloro-5H-pyrido[4,3-b]indole-4-carboxamide |
|---|---|
| PubChem CID | 88616795 |
| Molecular Formula | C12H7BrClN3O |
| Molecular Weight | 324.57 g/mol |
| Exact Mass | 322.95 |
| IUPAC Name | 3-bromo-1-chloro-5H-pyrido[4,3-b]indole-4-carboxamide |
| SMILES | NC(=O)c1c(Br)nc(Cl)c2c1[nH]c1ccccc12 |
| InChI | InChI=1S/C12H7BrClN3O/c13-10-8(12(15)18)9-7(11(14)17-10)5-3-1-2-4-6(5)16-9/h1-4,16H,(H2,15,18) |
| InChIKey | YWZQXQLMJWXXRI-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.57 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|